C19H22Cl2N4O3 — CID 18915202
(E)-N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 18915202) has the molecular formula C19H22Cl2N4O3 and a molecular weight of 425.32 g/mol. Its IUPAC name is (E)-N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18915202 |
| Molecular Formula | C19H22Cl2N4O3 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (E)-N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | CCCn1c(N)c(NC(=O)/C=C/c2ccc(Cl)c(Cl)c2)c(=O)n(CCC)c1=O |
| InChI | InChI=1S/C19H22Cl2N4O3/c1-3-9-24-17(22)16(18(27)25(10-4-2)19(24)28)23-15(26)8-6-12-5-7-13(20)14(21)11-12/h5-8,11H,3-4,9-10,22H2,1-2H3,(H,23,26)/b8-6+ |
| InChIKey | NPRROYAGOANWOW-SOFGYWHQSA-N |
| XLogP | 3.37 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|