C10H25N3 — CID 18916068
1-N'-(1-aminobutyl)-1-N'-ethylbutane-1,1-diamine (PubChem CID 18916068) has the molecular formula C10H25N3 and a molecular weight of 187.33 g/mol. Its IUPAC name is 1-N'-(1-aminobutyl)-1-N'-ethylbutane-1,1-diamine.
| Compound Name | 1-N'-(1-aminobutyl)-1-N'-ethylbutane-1,1-diamine |
|---|---|
| PubChem CID | 18916068 |
| Molecular Formula | C10H25N3 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.20 |
| IUPAC Name | 1-N'-(1-aminobutyl)-1-N'-ethylbutane-1,1-diamine |
| SMILES | CCCC(N)N(CC)C(N)CCC |
| InChI | InChI=1S/C10H25N3/c1-4-7-9(11)13(6-3)10(12)8-5-2/h9-10H,4-8,11-12H2,1-3H3 |
| InChIKey | TWBLFJZQSIBMNP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|