C15H18ClN3O2S — CID 18916415
ethyl N-(4-chloro-2-piperidin-1-yl-1,3-benzothiazol-7-yl)carbamate (PubChem CID 18916415) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is ethyl N-(4-chloro-2-piperidin-1-yl-1,3-benzothiazol-7-yl)carbamate.
| Compound Name | ethyl N-(4-chloro-2-piperidin-1-yl-1,3-benzothiazol-7-yl)carbamate |
|---|---|
| PubChem CID | 18916415 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | ethyl N-(4-chloro-2-piperidin-1-yl-1,3-benzothiazol-7-yl)carbamate |
| SMILES | CCOC(=O)Nc1ccc(Cl)c2nc(N3CCCCC3)sc12 |
| InChI | InChI=1S/C15H18ClN3O2S/c1-2-21-15(20)17-11-7-6-10(16)12-13(11)22-14(18-12)19-8-4-3-5-9-19/h6-7H,2-5,8-9H2,1H3,(H,17,20) |
| InChIKey | XIASDSGENCREDH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |