C12H6ClF4N5O2 — CID 18916417
3-(5-azido-4-chloro-2-fluorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 18916417) has the molecular formula C12H6ClF4N5O2 and a molecular weight of 363.66 g/mol. Its IUPAC name is 3-(5-azido-4-chloro-2-fluorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(5-azido-4-chloro-2-fluorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18916417 |
| Molecular Formula | C12H6ClF4N5O2 |
| Molecular Weight | 363.66 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 3-(5-azido-4-chloro-2-fluorophenyl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(-c2cc(N=[N+]=[N-])c(Cl)cc2F)c1=O |
| InChI | InChI=1S/C12H6ClF4N5O2/c1-21-9(12(15,16)17)4-10(23)22(11(21)24)8-3-7(19-20-18)5(13)2-6(8)14/h2-4H,1H3 |
| InChIKey | SXJPRXXLIIWDLG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.66 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|