About 4-fluoropent-2-yne
4-fluoropent-2-yne (PubChem CID 18917109) has the molecular formula C5H7F
and a molecular weight of 86.11 g/mol. Its IUPAC name is 4-fluoropent-2-yne.
Molecular Properties
| Compound Name | 4-fluoropent-2-yne |
| PubChem CID | 18917109 |
| Molecular Formula | C5H7F |
| Molecular Weight | 86.11 g/mol |
| Exact Mass | 86.05 |
| IUPAC Name | 4-fluoropent-2-yne |
| SMILES | CC#CC(C)F |
| InChI | InChI=1S/C5H7F/c1-3-4-5(2)6/h5H,1-2H3 |
| InChIKey | AABHUMDMWJKNNJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.11 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoropent-2-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoropent-2-yne?
The IUPAC name of 4-fluoropent-2-yne (CID 18917109) is 4-fluoropent-2-yne.
What is the SMILES notation for 4-fluoropent-2-yne?
The canonical SMILES for 4-fluoropent-2-yne is CC#CC(C)F.
What is the InChIKey of 4-fluoropent-2-yne?
The InChIKey is AABHUMDMWJKNNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F/c1-3-4-5(2)6/h5H,1-2H3.
What are the key properties of 4-fluoropent-2-yne?
4-fluoropent-2-yne has a molecular weight of 86.11 g/mol, XLogP of 1.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoropent-2-yne is sourced from PubChem (CID 18917109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).