About 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide
3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide (PubChem CID 18917698) has the molecular formula C15H14BrN3O
and a molecular weight of 332.20 g/mol. Its IUPAC name is 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide.
Molecular Properties
| Compound Name | 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide |
| PubChem CID | 18917698 |
| Molecular Formula | C15H14BrN3O |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide |
| SMILES | Br.NC1N=C(c2ccccc2)c2ccccc2NC1=O |
| InChI | InChI=1S/C15H13N3O.BrH/c16-14-15(19)17-12-9-5-4-8-11(12)13(18-14)10-6-2-1-3-7-10;/h1-9,14H,16H2,(H,17,19);1H |
| InChIKey | VMGBJEOFTZOWON-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide?
The IUPAC name of 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide (CID 18917698) is 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide.
What is the SMILES notation for 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide?
The canonical SMILES for 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide is Br.NC1N=C(c2ccccc2)c2ccccc2NC1=O.
What is the InChIKey of 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide?
The InChIKey is VMGBJEOFTZOWON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O.BrH/c16-14-15(19)17-12-9-5-4-8-11(12)13(18-14)10-6-2-1-3-7-10;/h1-9,14H,16H2,(H,17,19);1H.
What are the key properties of 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide?
3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide has a molecular weight of 332.20 g/mol, XLogP of 2.34, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one;hydrobromide is sourced from PubChem (CID 18917698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).