C24H30F3N3O4 — CID 18917846
tert-butyl N-[benzyl-[2-hydroxy-4-phenyl-3-[(2,2,2-trifluoroacetyl)amino]butyl]amino]carbamate (PubChem CID 18917846) has the molecular formula C24H30F3N3O4 and a molecular weight of 481.52 g/mol. Its IUPAC name is tert-butyl N-[benzyl-[2-hydroxy-4-phenyl-3-[(2,2,2-trifluoroacetyl)amino]butyl]amino]carbamate.
| Compound Name | tert-butyl N-[benzyl-[2-hydroxy-4-phenyl-3-[(2,2,2-trifluoroacetyl)amino]butyl]amino]carbamate |
|---|---|
| PubChem CID | 18917846 |
| Molecular Formula | C24H30F3N3O4 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | tert-butyl N-[benzyl-[2-hydroxy-4-phenyl-3-[(2,2,2-trifluoroacetyl)amino]butyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(Cc1ccccc1)CC(O)C(Cc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C24H30F3N3O4/c1-23(2,3)34-22(33)29-30(15-18-12-8-5-9-13-18)16-20(31)19(28-21(32)24(25,26)27)14-17-10-6-4-7-11-17/h4-13,19-20,31H,14-16H2,1-3H3,(H,28,32)(H,29,33) |
| InChIKey | DGFMWEDWGCTGQW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|