C13H9ClFN3O — CID 18918168
13-fluoro-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one;hydrochloride (PubChem CID 18918168) has the molecular formula C13H9ClFN3O and a molecular weight of 277.69 g/mol. Its IUPAC name is 13-fluoro-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one;hydrochloride.
| Compound Name | 13-fluoro-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one;hydrochloride |
|---|---|
| PubChem CID | 18918168 |
| Molecular Formula | C13H9ClFN3O |
| Molecular Weight | 277.69 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 13-fluoro-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c2c(n3ccnc13)Cc1cc(F)ccc1-2 |
| InChI | InChI=1S/C13H8FN3O.ClH/c14-8-1-2-9-7(5-8)6-10-11(9)16-13(18)12-15-3-4-17(10)12;/h1-5H,6H2,(H,16,18);1H |
| InChIKey | BORYZABYOZBRGX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.69 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |