C10H10N2OS — CID 18918914
3,6-dimethyl-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 18918914) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 3,6-dimethyl-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3,6-dimethyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 18918914 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 3,6-dimethyl-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | Cc1ccc2[nH]c(=S)n(C)c(=O)c2c1 |
| InChI | InChI=1S/C10H10N2OS/c1-6-3-4-8-7(5-6)9(13)12(2)10(14)11-8/h3-5H,1-2H3,(H,11,14) |
| InChIKey | FVXUYCAQINXRCR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|