About 2H-pyrimido[2,1-b][1,3]thiazin-6-one
2H-pyrimido[2,1-b][1,3]thiazin-6-one (PubChem CID 18919072) has the molecular formula C7H6N2OS
and a molecular weight of 166.20 g/mol. Its IUPAC name is 2H-pyrimido[2,1-b][1,3]thiazin-6-one.
Molecular Properties
| Compound Name | 2H-pyrimido[2,1-b][1,3]thiazin-6-one |
| PubChem CID | 18919072 |
| Molecular Formula | C7H6N2OS |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 2H-pyrimido[2,1-b][1,3]thiazin-6-one |
| SMILES | O=c1ccnc2n1C=CCS2 |
| InChI | InChI=1S/C7H6N2OS/c10-6-2-3-8-7-9(6)4-1-5-11-7/h1-4H,5H2 |
| InChIKey | HGSJSGJZOMBIAB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-pyrimido[2,1-b][1,3]thiazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrimido[2,1-b][1,3]thiazin-6-one?
The IUPAC name of 2H-pyrimido[2,1-b][1,3]thiazin-6-one (CID 18919072) is 2H-pyrimido[2,1-b][1,3]thiazin-6-one.
What is the SMILES notation for 2H-pyrimido[2,1-b][1,3]thiazin-6-one?
The canonical SMILES for 2H-pyrimido[2,1-b][1,3]thiazin-6-one is O=c1ccnc2n1C=CCS2.
What is the InChIKey of 2H-pyrimido[2,1-b][1,3]thiazin-6-one?
The InChIKey is HGSJSGJZOMBIAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS/c10-6-2-3-8-7-9(6)4-1-5-11-7/h1-4H,5H2.
What are the key properties of 2H-pyrimido[2,1-b][1,3]thiazin-6-one?
2H-pyrimido[2,1-b][1,3]thiazin-6-one has a molecular weight of 166.20 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrimido[2,1-b][1,3]thiazin-6-one is sourced from PubChem (CID 18919072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).