C22H16ClN3O3 — CID 18919290
2-[[4-(6-chloropyridine-3-carbonyl)phenyl]methoxy]-3-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 18919290) has the molecular formula C22H16ClN3O3 and a molecular weight of 405.84 g/mol. Its IUPAC name is 2-[[4-(6-chloropyridine-3-carbonyl)phenyl]methoxy]-3-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[4-(6-chloropyridine-3-carbonyl)phenyl]methoxy]-3-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 18919290 |
| Molecular Formula | C22H16ClN3O3 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-[[4-(6-chloropyridine-3-carbonyl)phenyl]methoxy]-3-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1c(OCc2ccc(C(=O)c3ccc(Cl)nc3)cc2)nc2ccccn2c1=O |
| InChI | InChI=1S/C22H16ClN3O3/c1-14-21(25-19-4-2-3-11-26(19)22(14)28)29-13-15-5-7-16(8-6-15)20(27)17-9-10-18(23)24-12-17/h2-12H,13H2,1H3 |
| InChIKey | SIJJBLDQJSRRGF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|