C12H13ClN2O3 — CID 18919516
ethyl 5-carbamimidoyl-1-benzofuran-2-carboxylate;hydrochloride (PubChem CID 18919516) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is ethyl 5-carbamimidoyl-1-benzofuran-2-carboxylate;hydrochloride.
| Compound Name | ethyl 5-carbamimidoyl-1-benzofuran-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 18919516 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | ethyl 5-carbamimidoyl-1-benzofuran-2-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc2oc(C(=O)OCC)cc2c1 |
| InChI | InChI=1S/C12H12N2O3.ClH/c1-2-16-12(15)10-6-8-5-7(11(13)14)3-4-9(8)17-10;/h3-6H,2H2,1H3,(H3,13,14);1H |
| InChIKey | JTNSCGWSAHTXDL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|