About 5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride
5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride (PubChem CID 18919570) has the molecular formula C14H28Cl2N2O2
and a molecular weight of 327.30 g/mol. Its IUPAC name is 5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride.
Molecular Properties
| Compound Name | 5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride |
| PubChem CID | 18919570 |
| Molecular Formula | C14H28Cl2N2O2 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride |
| SMILES | CC(=O)OCCCCCN1C2CCC1CC(N)C2.Cl.Cl |
| InChI | InChI=1S/C14H26N2O2.2ClH/c1-11(17)18-8-4-2-3-7-16-13-5-6-14(16)10-12(15)9-13;;/h12-14H,2-10,15H2,1H3;2*1H |
| InChIKey | VDWFGAXVMWXWQK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride?
The IUPAC name of 5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride (CID 18919570) is 5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride.
What is the SMILES notation for 5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride?
The canonical SMILES for 5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride is CC(=O)OCCCCCN1C2CCC1CC(N)C2.Cl.Cl.
What is the InChIKey of 5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride?
The InChIKey is VDWFGAXVMWXWQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2.2ClH/c1-11(17)18-8-4-2-3-7-16-13-5-6-14(16)10-12(15)9-13;;/h12-14H,2-10,15H2,1H3;2*1H.
What are the key properties of 5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride?
5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride has a molecular weight of 327.30 g/mol, XLogP of 2.52, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)pentyl acetate;dihydrochloride is sourced from PubChem (CID 18919570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).