C15H13N5O4S — CID 18920145
2-cyano-N-(diaminomethylidene)-5-methylsulfonyl-4-(4-oxo-1-pyridinyl)benzamide (PubChem CID 18920145) has the molecular formula C15H13N5O4S and a molecular weight of 359.37 g/mol. Its IUPAC name is 2-cyano-N-(diaminomethylidene)-5-methylsulfonyl-4-(4-oxo-1-pyridinyl)benzamide.
| Compound Name | 2-cyano-N-(diaminomethylidene)-5-methylsulfonyl-4-(4-oxo-1-pyridinyl)benzamide |
|---|---|
| PubChem CID | 18920145 |
| Molecular Formula | C15H13N5O4S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-cyano-N-(diaminomethylidene)-5-methylsulfonyl-4-(4-oxo-1-pyridinyl)benzamide |
| SMILES | CS(=O)(=O)c1cc(C(=O)N=C(N)N)c(C#N)cc1-n1ccc(=O)cc1 |
| InChI | InChI=1S/C15H13N5O4S/c1-25(23,24)13-7-11(14(22)19-15(17)18)9(8-16)6-12(13)20-4-2-10(21)3-5-20/h2-7H,1H3,(H4,17,18,19,22) |
| InChIKey | TVOIRBMEJGUEBW-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 161.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|