C13H21N3OS — CID 18920262
3-butoxy-4-(1,2-dimethyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole (PubChem CID 18920262) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 3-butoxy-4-(1,2-dimethyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole.
| Compound Name | 3-butoxy-4-(1,2-dimethyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 18920262 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-butoxy-4-(1,2-dimethyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole |
| SMILES | CCCCOc1nsnc1C1=CCC(C)N(C)C1 |
| InChI | InChI=1S/C13H21N3OS/c1-4-5-8-17-13-12(14-18-15-13)11-7-6-10(2)16(3)9-11/h7,10H,4-6,8-9H2,1-3H3 |
| InChIKey | YGJVFXOACAMRAX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|