About propane-1-sulfonate;propylazanium
propane-1-sulfonate;propylazanium (PubChem CID 18920642) has the molecular formula C6H17NO3S
and a molecular weight of 183.27 g/mol. Its IUPAC name is propane-1-sulfonate;propylazanium.
Molecular Properties
| Compound Name | propane-1-sulfonate;propylazanium |
| PubChem CID | 18920642 |
| Molecular Formula | C6H17NO3S |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | propane-1-sulfonate;propylazanium |
| SMILES | CCCS(=O)(=O)[O-].CCC[NH3+] |
| InChI | InChI=1S/C3H9N.C3H8O3S/c1-2-3-4;1-2-3-7(4,5)6/h2-4H2,1H3;2-3H2,1H3,(H,4,5,6) |
| InChIKey | YFHIKONGZDBOMY-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze propane-1-sulfonate;propylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1-sulfonate;propylazanium?
The IUPAC name of propane-1-sulfonate;propylazanium (CID 18920642) is propane-1-sulfonate;propylazanium.
What is the SMILES notation for propane-1-sulfonate;propylazanium?
The canonical SMILES for propane-1-sulfonate;propylazanium is CCCS(=O)(=O)[O-].CCC[NH3+].
What is the InChIKey of propane-1-sulfonate;propylazanium?
The InChIKey is YFHIKONGZDBOMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C3H8O3S/c1-2-3-4;1-2-3-7(4,5)6/h2-4H2,1H3;2-3H2,1H3,(H,4,5,6).
What are the key properties of propane-1-sulfonate;propylazanium?
propane-1-sulfonate;propylazanium has a molecular weight of 183.27 g/mol, XLogP of -0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1-sulfonate;propylazanium is sourced from PubChem (CID 18920642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).