C16H7F8N3O2 — CID 18921401
2-(1,1,2,2,2-pentafluoroethyl)-5-[6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]-1,3,4-oxadiazole (PubChem CID 18921401) has the molecular formula C16H7F8N3O2 and a molecular weight of 425.24 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-5-[6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]-1,3,4-oxadiazole.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-5-[6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 18921401 |
| Molecular Formula | C16H7F8N3O2 |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-5-[6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]-1,3,4-oxadiazole |
| SMILES | FC(F)(F)c1cccc(Oc2cccc(-c3nnc(C(F)(F)C(F)(F)F)o3)n2)c1 |
| InChI | InChI=1S/C16H7F8N3O2/c17-14(18,16(22,23)24)13-27-26-12(29-13)10-5-2-6-11(25-10)28-9-4-1-3-8(7-9)15(19,20)21/h1-7H |
| InChIKey | QZRQQFHALNOFPK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|