C15H12F3N4O5P — CID 18921556
[8-imidazol-1-yl-2,3-dioxo-7-(trifluoromethyl)-1,4-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-12-yl]phosphonic acid (PubChem CID 18921556) has the molecular formula C15H12F3N4O5P and a molecular weight of 416.25 g/mol. Its IUPAC name is [8-imidazol-1-yl-2,3-dioxo-7-(trifluoromethyl)-1,4-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-12-yl]phosphonic acid.
| Compound Name | [8-imidazol-1-yl-2,3-dioxo-7-(trifluoromethyl)-1,4-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-12-yl]phosphonic acid |
|---|---|
| PubChem CID | 18921556 |
| Molecular Formula | C15H12F3N4O5P |
| Molecular Weight | 416.25 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | [8-imidazol-1-yl-2,3-dioxo-7-(trifluoromethyl)-1,4-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-12-yl]phosphonic acid |
| SMILES | O=c1[nH]c2cc(C(F)(F)F)c(-n3ccnc3)c3c2n(c1=O)C(P(=O)(O)O)CC3 |
| InChI | InChI=1S/C15H12F3N4O5P/c16-15(17,18)8-5-9-12-7(11(8)21-4-3-19-6-21)1-2-10(28(25,26)27)22(12)14(24)13(23)20-9/h3-6,10H,1-2H2,(H,20,23)(H2,25,26,27) |
| InChIKey | TZMNCVTWMJHHBC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|