C7H3F4N3OS — CID 18922259
2-(2,3,5,6-tetrafluoro-4-pyridinyl)-1,2,5-thiadiazolidin-3-one (PubChem CID 18922259) has the molecular formula C7H3F4N3OS and a molecular weight of 253.18 g/mol. Its IUPAC name is 2-(2,3,5,6-tetrafluoro-4-pyridinyl)-1,2,5-thiadiazolidin-3-one.
| Compound Name | 2-(2,3,5,6-tetrafluoro-4-pyridinyl)-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 18922259 |
| Molecular Formula | C7H3F4N3OS |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | 2-(2,3,5,6-tetrafluoro-4-pyridinyl)-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CNSN1c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C7H3F4N3OS/c8-3-5(14-2(15)1-12-16-14)4(9)7(11)13-6(3)10/h12H,1H2 |
| InChIKey | WTPDMUCVUNONIT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|