About 5-phenylimidazo[5,1-b][1,3]thiazole
5-phenylimidazo[5,1-b][1,3]thiazole (PubChem CID 18922518) has the molecular formula C11H8N2S
and a molecular weight of 200.27 g/mol. Its IUPAC name is 5-phenylimidazo[5,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 5-phenylimidazo[5,1-b][1,3]thiazole |
| PubChem CID | 18922518 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 5-phenylimidazo[5,1-b][1,3]thiazole |
| SMILES | c1ccc(-c2ncc3sccn23)cc1 |
| InChI | InChI=1S/C11H8N2S/c1-2-4-9(5-3-1)11-12-8-10-13(11)6-7-14-10/h1-8H |
| InChIKey | HUXMIVMRGDSRCC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-phenylimidazo[5,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylimidazo[5,1-b][1,3]thiazole?
The IUPAC name of 5-phenylimidazo[5,1-b][1,3]thiazole (CID 18922518) is 5-phenylimidazo[5,1-b][1,3]thiazole.
What is the SMILES notation for 5-phenylimidazo[5,1-b][1,3]thiazole?
The canonical SMILES for 5-phenylimidazo[5,1-b][1,3]thiazole is c1ccc(-c2ncc3sccn23)cc1.
What is the InChIKey of 5-phenylimidazo[5,1-b][1,3]thiazole?
The InChIKey is HUXMIVMRGDSRCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2S/c1-2-4-9(5-3-1)11-12-8-10-13(11)6-7-14-10/h1-8H.
What are the key properties of 5-phenylimidazo[5,1-b][1,3]thiazole?
5-phenylimidazo[5,1-b][1,3]thiazole has a molecular weight of 200.27 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylimidazo[5,1-b][1,3]thiazole is sourced from PubChem (CID 18922518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).