About 3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide
3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide (PubChem CID 18923065) has the molecular formula C10H8N2OS2
and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide.
Molecular Properties
| Compound Name | 3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide |
| PubChem CID | 18923065 |
| Molecular Formula | C10H8N2OS2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide |
| SMILES | NC(=O)c1cccc(-c2csc(=S)[nH]2)c1 |
| InChI | InChI=1S/C10H8N2OS2/c11-9(13)7-3-1-2-6(4-7)8-5-15-10(14)12-8/h1-5H,(H2,11,13)(H,12,14) |
| InChIKey | SQLFVMITNULICG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide?
The IUPAC name of 3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide (CID 18923065) is 3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide.
What is the SMILES notation for 3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide?
The canonical SMILES for 3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide is NC(=O)c1cccc(-c2csc(=S)[nH]2)c1.
What is the InChIKey of 3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide?
The InChIKey is SQLFVMITNULICG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2OS2/c11-9(13)7-3-1-2-6(4-7)8-5-15-10(14)12-8/h1-5H,(H2,11,13)(H,12,14).
What are the key properties of 3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide?
3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide has a molecular weight of 236.32 g/mol, XLogP of 2.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)benzamide is sourced from PubChem (CID 18923065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).