C25H29BrCl2N4O3 — CID 18923575
N-[2-[3-[(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)oxymethyl]-2,4-dichloro-N-methylanilino]-2-oxoethyl]heptanamide (PubChem CID 18923575) has the molecular formula C25H29BrCl2N4O3 and a molecular weight of 584.34 g/mol. Its IUPAC name is N-[2-[3-[(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)oxymethyl]-2,4-dichloro-N-methylanilino]-2-oxoethyl]heptanamide.
| Compound Name | N-[2-[3-[(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)oxymethyl]-2,4-dichloro-N-methylanilino]-2-oxoethyl]heptanamide |
|---|---|
| PubChem CID | 18923575 |
| Molecular Formula | C25H29BrCl2N4O3 |
| Molecular Weight | 584.34 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | N-[2-[3-[(3-bromo-2-methylimidazo[1,2-a]pyridin-8-yl)oxymethyl]-2,4-dichloro-N-methylanilino]-2-oxoethyl]heptanamide |
| SMILES | CCCCCCC(=O)NCC(=O)N(C)c1ccc(Cl)c(COc2cccn3c(Br)c(C)nc23)c1Cl |
| InChI | InChI=1S/C25H29BrCl2N4O3/c1-4-5-6-7-10-21(33)29-14-22(34)31(3)19-12-11-18(27)17(23(19)28)15-35-20-9-8-13-32-24(26)16(2)30-25(20)32/h8-9,11-13H,4-7,10,14-15H2,1-3H3,(H,29,33) |
| InChIKey | NITUQZJLUWPDNA-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.34 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|