C32H27NO3 — CID 18923794
3,6-bis(4-methoxyphenyl)-2-(4-phenylmethoxyphenyl)pyridine (PubChem CID 18923794) has the molecular formula C32H27NO3 and a molecular weight of 473.57 g/mol. Its IUPAC name is 3,6-bis(4-methoxyphenyl)-2-(4-phenylmethoxyphenyl)pyridine.
| Compound Name | 3,6-bis(4-methoxyphenyl)-2-(4-phenylmethoxyphenyl)pyridine |
|---|---|
| PubChem CID | 18923794 |
| Molecular Formula | C32H27NO3 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 3,6-bis(4-methoxyphenyl)-2-(4-phenylmethoxyphenyl)pyridine |
| SMILES | COc1ccc(-c2ccc(-c3ccc(OC)cc3)c(-c3ccc(OCc4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C32H27NO3/c1-34-27-14-8-24(9-15-27)30-20-21-31(25-10-16-28(35-2)17-11-25)33-32(30)26-12-18-29(19-13-26)36-22-23-6-4-3-5-7-23/h3-21H,22H2,1-2H3 |
| InChIKey | ISOCRMBLPRETIP-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |