C4H5F3O2 — CID 18923914
2-(difluoromethyl)-2-fluoro-1,3-dioxolane (PubChem CID 18923914) has the molecular formula C4H5F3O2 and a molecular weight of 142.08 g/mol. Its IUPAC name is 2-(difluoromethyl)-2-fluoro-1,3-dioxolane.
| Compound Name | 2-(difluoromethyl)-2-fluoro-1,3-dioxolane |
|---|---|
| PubChem CID | 18923914 |
| Molecular Formula | C4H5F3O2 |
| Molecular Weight | 142.08 g/mol |
| Exact Mass | 142.02 |
| IUPAC Name | 2-(difluoromethyl)-2-fluoro-1,3-dioxolane |
| SMILES | FC(F)C1(F)OCCO1 |
| InChI | InChI=1S/C4H5F3O2/c5-3(6)4(7)8-1-2-9-4/h3H,1-2H2 |
| InChIKey | PQHCIAURUNELHJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.08 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |