C4HF7O — CID 18924230
2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanal (PubChem CID 18924230) has the molecular formula C4HF7O and a molecular weight of 198.04 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanal.
| Compound Name | 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanal |
|---|---|
| PubChem CID | 18924230 |
| Molecular Formula | C4HF7O |
| Molecular Weight | 198.04 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanal |
| SMILES | O=CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4HF7O/c5-2(1-12,3(6,7)8)4(9,10)11/h1H |
| InChIKey | YONMYGSGTFAPIN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.04 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|