About 2-(2,2-difluoroethoxy)-1,1-difluoroethane
2-(2,2-difluoroethoxy)-1,1-difluoroethane (PubChem CID 18924246) has the molecular formula C4H6F4O
and a molecular weight of 146.08 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-1,1-difluoroethane.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethoxy)-1,1-difluoroethane |
| PubChem CID | 18924246 |
| Molecular Formula | C4H6F4O |
| Molecular Weight | 146.08 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-1,1-difluoroethane |
| SMILES | FC(F)COCC(F)F |
| InChI | InChI=1S/C4H6F4O/c5-3(6)1-9-2-4(7)8/h3-4H,1-2H2 |
| InChIKey | MHLLQRDUPCIDMR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.08 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,2-difluoroethoxy)-1,1-difluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethoxy)-1,1-difluoroethane?
The IUPAC name of 2-(2,2-difluoroethoxy)-1,1-difluoroethane (CID 18924246) is 2-(2,2-difluoroethoxy)-1,1-difluoroethane.
What is the SMILES notation for 2-(2,2-difluoroethoxy)-1,1-difluoroethane?
The canonical SMILES for 2-(2,2-difluoroethoxy)-1,1-difluoroethane is FC(F)COCC(F)F.
What is the InChIKey of 2-(2,2-difluoroethoxy)-1,1-difluoroethane?
The InChIKey is MHLLQRDUPCIDMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F4O/c5-3(6)1-9-2-4(7)8/h3-4H,1-2H2.
What are the key properties of 2-(2,2-difluoroethoxy)-1,1-difluoroethane?
2-(2,2-difluoroethoxy)-1,1-difluoroethane has a molecular weight of 146.08 g/mol, XLogP of 1.53, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethoxy)-1,1-difluoroethane is sourced from PubChem (CID 18924246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).