About 9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide
9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide (PubChem CID 18924283) has the molecular formula C26H36F2NO4P
and a molecular weight of 495.55 g/mol. Its IUPAC name is 9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide.
Molecular Properties
| Compound Name | 9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide |
| PubChem CID | 18924283 |
| Molecular Formula | C26H36F2NO4P |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide |
| SMILES | CCCCOP(=O)(CCCCC1c2cc(F)ccc2-c2ccc(F)cc21)OCCCC.NC=O |
| InChI | InChI=1S/C25H33F2O3P.CH3NO/c1-3-5-14-29-31(28,30-15-6-4-2)16-8-7-9-21-24-17-19(26)10-12-22(24)23-13-11-20(27)18-25(21)23;2-1-3/h10-13,17-18,21H,3-9,14-16H2,1-2H3;1H,(H2,2,3) |
| InChIKey | XFGPVRZUTLTMNE-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide?
The IUPAC name of 9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide (CID 18924283) is 9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide.
What is the SMILES notation for 9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide?
The canonical SMILES for 9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide is CCCCOP(=O)(CCCCC1c2cc(F)ccc2-c2ccc(F)cc21)OCCCC.NC=O.
What is the InChIKey of 9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide?
The InChIKey is XFGPVRZUTLTMNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33F2O3P.CH3NO/c1-3-5-14-29-31(28,30-15-6-4-2)16-8-7-9-21-24-17-19(26)10-12-22(24)23-13-11-20(27)18-25(21)23;2-1-3/h10-13,17-18,21H,3-9,14-16H2,1-2H3;1H,(H2,2,3).
What are the key properties of 9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide?
9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide has a molecular weight of 495.55 g/mol, XLogP of 7.18, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-dibutoxyphosphorylbutyl)-2,7-difluoro-9H-fluorene;formamide is sourced from PubChem (CID 18924283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).