About 3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane
3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane (PubChem CID 18924374) has the molecular formula C6H11F3O5S
and a molecular weight of 252.21 g/mol. Its IUPAC name is 3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane.
Molecular Properties
| Compound Name | 3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane |
| PubChem CID | 18924374 |
| Molecular Formula | C6H11F3O5S |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane |
| SMILES | COC(F)(F)F.COCC1COS1(=O)=O |
| InChI | InChI=1S/C4H8O4S.C2H3F3O/c1-7-2-4-3-8-9(4,5)6;1-6-2(3,4)5/h4H,2-3H2,1H3;1H3 |
| InChIKey | RRXHVPSJFYQBAT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane?
The IUPAC name of 3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane (CID 18924374) is 3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane.
What is the SMILES notation for 3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane?
The canonical SMILES for 3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane is COC(F)(F)F.COCC1COS1(=O)=O.
What is the InChIKey of 3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane?
The InChIKey is RRXHVPSJFYQBAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O4S.C2H3F3O/c1-7-2-4-3-8-9(4,5)6;1-6-2(3,4)5/h4H,2-3H2,1H3;1H3.
What are the key properties of 3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane?
3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane has a molecular weight of 252.21 g/mol, XLogP of 0.51, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)oxathietane 2,2-dioxide;trifluoro(methoxy)methane is sourced from PubChem (CID 18924374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).