C19H21N5O3 — CID 18925210
1-[(E)-4-azidobut-2-enyl]-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione (PubChem CID 18925210) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-[(E)-4-azidobut-2-enyl]-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione.
| Compound Name | 1-[(E)-4-azidobut-2-enyl]-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18925210 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-[(E)-4-azidobut-2-enyl]-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione |
| SMILES | CCc1c(C(=O)c2cc(C)cc(C)c2)n(C/C=C/CN=[N+]=[N-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H21N5O3/c1-4-15-16(17(25)14-10-12(2)9-13(3)11-14)24(19(27)22-18(15)26)8-6-5-7-21-23-20/h5-6,9-11H,4,7-8H2,1-3H3,(H,22,26,27)/b6-5+ |
| InChIKey | QKLMEQGNRBXBMB-AATRIKPKSA-N |
| XLogP | 2.81 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|