About indeno[1,2-b]pyrrole
indeno[1,2-b]pyrrole (PubChem CID 18925321) has the molecular formula C11H7N
and a molecular weight of 153.18 g/mol. Its IUPAC name is indeno[1,2-b]pyrrole.
Molecular Properties
| Compound Name | indeno[1,2-b]pyrrole |
| PubChem CID | 18925321 |
| Molecular Formula | C11H7N |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | indeno[1,2-b]pyrrole |
| SMILES | C1=NC2=c3ccccc3=CC2=C1 |
| InChI | InChI=1S/C11H7N/c1-2-4-10-8(3-1)7-9-5-6-12-11(9)10/h1-7H |
| InChIKey | FXRUZTVTYLZXGA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze indeno[1,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indeno[1,2-b]pyrrole?
The IUPAC name of indeno[1,2-b]pyrrole (CID 18925321) is indeno[1,2-b]pyrrole.
What is the SMILES notation for indeno[1,2-b]pyrrole?
The canonical SMILES for indeno[1,2-b]pyrrole is C1=NC2=c3ccccc3=CC2=C1.
What is the InChIKey of indeno[1,2-b]pyrrole?
The InChIKey is FXRUZTVTYLZXGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N/c1-2-4-10-8(3-1)7-9-5-6-12-11(9)10/h1-7H.
What are the key properties of indeno[1,2-b]pyrrole?
indeno[1,2-b]pyrrole has a molecular weight of 153.18 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for indeno[1,2-b]pyrrole is sourced from PubChem (CID 18925321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).