C16H30N2O5 — CID 18925471
tert-butyl 2-[1-[2-(2-methoxyethylamino)acetyl]piperidin-4-yl]oxyacetate (PubChem CID 18925471) has the molecular formula C16H30N2O5 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl 2-[1-[2-(2-methoxyethylamino)acetyl]piperidin-4-yl]oxyacetate.
| Compound Name | tert-butyl 2-[1-[2-(2-methoxyethylamino)acetyl]piperidin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 18925471 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | tert-butyl 2-[1-[2-(2-methoxyethylamino)acetyl]piperidin-4-yl]oxyacetate |
| SMILES | COCCNCC(=O)N1CCC(OCC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30N2O5/c1-16(2,3)23-15(20)12-22-13-5-8-18(9-6-13)14(19)11-17-7-10-21-4/h13,17H,5-12H2,1-4H3 |
| InChIKey | NDIQTIDZLJKIOD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|