C20H11Cl2F12N3O3 — CID 18925618
4-chloro-N-(diaminomethylidene)-2,5-bis(trifluoromethyl)benzamide;methyl 4-chloro-2,5-bis(trifluoromethyl)benzoate (PubChem CID 18925618) has the molecular formula C20H11Cl2F12N3O3 and a molecular weight of 640.21 g/mol. Its IUPAC name is 4-chloro-N-(diaminomethylidene)-2,5-bis(trifluoromethyl)benzamide;methyl 4-chloro-2,5-bis(trifluoromethyl)benzoate.
| Compound Name | 4-chloro-N-(diaminomethylidene)-2,5-bis(trifluoromethyl)benzamide;methyl 4-chloro-2,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 18925618 |
| Molecular Formula | C20H11Cl2F12N3O3 |
| Molecular Weight | 640.21 g/mol |
| Exact Mass | 639.00 |
| IUPAC Name | 4-chloro-N-(diaminomethylidene)-2,5-bis(trifluoromethyl)benzamide;methyl 4-chloro-2,5-bis(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1cc(C(F)(F)F)c(Cl)cc1C(F)(F)F.NC(N)=NC(=O)c1cc(C(F)(F)F)c(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C10H6ClF6N3O.C10H5ClF6O2/c11-6-2-4(9(12,13)14)3(7(21)20-8(18)19)1-5(6)10(15,16)17;1-19-8(18)4-2-6(10(15,16)17)7(11)3-5(4)9(12,13)14/h1-2H,(H4,18,19,20,21);2-3H,1H3 |
| InChIKey | OADNYVGEAJLSLG-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.21 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|