C20H13F12N3O3 — CID 18925642
N-(diaminomethylidene)-2,4-bis(trifluoromethyl)benzamide;methyl 2,4-bis(trifluoromethyl)benzoate (PubChem CID 18925642) has the molecular formula C20H13F12N3O3 and a molecular weight of 571.32 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,4-bis(trifluoromethyl)benzamide;methyl 2,4-bis(trifluoromethyl)benzoate.
| Compound Name | N-(diaminomethylidene)-2,4-bis(trifluoromethyl)benzamide;methyl 2,4-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 18925642 |
| Molecular Formula | C20H13F12N3O3 |
| Molecular Weight | 571.32 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | N-(diaminomethylidene)-2,4-bis(trifluoromethyl)benzamide;methyl 2,4-bis(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1ccc(C(F)(F)F)cc1C(F)(F)F.NC(N)=NC(=O)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H7F6N3O.C10H6F6O2/c11-9(12,13)4-1-2-5(7(20)19-8(17)18)6(3-4)10(14,15)16;1-18-8(17)6-3-2-5(9(11,12)13)4-7(6)10(14,15)16/h1-3H,(H4,17,18,19,20);2-4H,1H3 |
| InChIKey | JOMHEHVWVZQAOP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.32 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|