C22H23F6N3O3 — CID 18925676
N-(diaminomethylidene)-2,4-dimethyl-5-(trifluoromethyl)benzamide;methyl 2,4-dimethyl-5-(trifluoromethyl)benzoate (PubChem CID 18925676) has the molecular formula C22H23F6N3O3 and a molecular weight of 491.43 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,4-dimethyl-5-(trifluoromethyl)benzamide;methyl 2,4-dimethyl-5-(trifluoromethyl)benzoate.
| Compound Name | N-(diaminomethylidene)-2,4-dimethyl-5-(trifluoromethyl)benzamide;methyl 2,4-dimethyl-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 18925676 |
| Molecular Formula | C22H23F6N3O3 |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N-(diaminomethylidene)-2,4-dimethyl-5-(trifluoromethyl)benzamide;methyl 2,4-dimethyl-5-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1cc(C(F)(F)F)c(C)cc1C.Cc1cc(C)c(C(F)(F)F)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C11H12F3N3O.C11H11F3O2/c1-5-3-6(2)8(11(12,13)14)4-7(5)9(18)17-10(15)16;1-6-4-7(2)9(11(12,13)14)5-8(6)10(15)16-3/h3-4H,1-2H3,(H4,15,16,17,18);4-5H,1-3H3 |
| InChIKey | YFCJSGWIKOXOFP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|