About N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide
N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide (PubChem CID 18925751) has the molecular formula C15H20F3N3O
and a molecular weight of 315.34 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide |
| PubChem CID | 18925751 |
| Molecular Formula | C15H20F3N3O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide |
| SMILES | CC(C)c1cc(C(C)C)c(C(F)(F)F)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C15H20F3N3O/c1-7(2)9-5-10(8(3)4)12(15(16,17)18)6-11(9)13(22)21-14(19)20/h5-8H,1-4H3,(H4,19,20,21,22) |
| InChIKey | QZKBAZCENAVTFB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide?
The IUPAC name of N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide (CID 18925751) is N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide.
What is the SMILES notation for N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide?
The canonical SMILES for N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide is CC(C)c1cc(C(C)C)c(C(F)(F)F)cc1C(=O)N=C(N)N.
What is the InChIKey of N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide?
The InChIKey is QZKBAZCENAVTFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F3N3O/c1-7(2)9-5-10(8(3)4)12(15(16,17)18)6-11(9)13(22)21-14(19)20/h5-8H,1-4H3,(H4,19,20,21,22).
What are the key properties of N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide?
N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide has a molecular weight of 315.34 g/mol, XLogP of 3.37, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)-2,4-di(propan-2-yl)-5-(trifluoromethyl)benzamide is sourced from PubChem (CID 18925751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).