C11H18Ti — CID 18925878
ethane;1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium(2+) (PubChem CID 18925878) has the molecular formula C11H18Ti and a molecular weight of 198.13 g/mol. Its IUPAC name is ethane;1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium(2+).
| Compound Name | ethane;1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium(2+) |
|---|---|
| PubChem CID | 18925878 |
| Molecular Formula | C11H18Ti |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | ethane;1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium(2+) |
| SMILES | CC1=[C-]C(C)C(C)=C1C.[CH2-]C.[Ti+2] |
| InChI | InChI=1S/C9H13.C2H5.Ti/c1-6-5-7(2)9(4)8(6)3;1-2;/h6H,1-4H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | OQJGLDKPGRTVFK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|