C12H22N2 — CID 18926376
N-methyl-7-propan-2-yl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine (PubChem CID 18926376) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N-methyl-7-propan-2-yl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine.
| Compound Name | N-methyl-7-propan-2-yl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine |
|---|---|
| PubChem CID | 18926376 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-methyl-7-propan-2-yl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine |
| SMILES | CNC1C=CC(C(C)C)C2CNCC12 |
| InChI | InChI=1S/C12H22N2/c1-8(2)9-4-5-12(13-3)11-7-14-6-10(9)11/h4-5,8-14H,6-7H2,1-3H3 |
| InChIKey | LYKNTLRUUFDJEK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|