C10H18N2 — CID 18926378
N,N-dimethyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine (PubChem CID 18926378) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N,N-dimethyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine.
| Compound Name | N,N-dimethyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine |
|---|---|
| PubChem CID | 18926378 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N,N-dimethyl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine |
| SMILES | CN(C)C1C=CCC2CNCC21 |
| InChI | InChI=1S/C10H18N2/c1-12(2)10-5-3-4-8-6-11-7-9(8)10/h3,5,8-11H,4,6-7H2,1-2H3 |
| InChIKey | BUYXVBOFHPFEIB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|