C45H42N10O8 — CID 18926676
methyl 4-[[4-[5-[4,6-bis(4-methoxycarbonylanilino)-1,3,5-triazin-2-yl]-2-bicyclo[2.2.1]heptanyl]-6-(4-methoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 18926676) has the molecular formula C45H42N10O8 and a molecular weight of 850.89 g/mol. Its IUPAC name is methyl 4-[[4-[5-[4,6-bis(4-methoxycarbonylanilino)-1,3,5-triazin-2-yl]-2-bicyclo[2.2.1]heptanyl]-6-(4-methoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | methyl 4-[[4-[5-[4,6-bis(4-methoxycarbonylanilino)-1,3,5-triazin-2-yl]-2-bicyclo[2.2.1]heptanyl]-6-(4-methoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 18926676 |
| Molecular Formula | C45H42N10O8 |
| Molecular Weight | 850.89 g/mol |
| Exact Mass | 850.32 |
| IUPAC Name | methyl 4-[[4-[5-[4,6-bis(4-methoxycarbonylanilino)-1,3,5-triazin-2-yl]-2-bicyclo[2.2.1]heptanyl]-6-(4-methoxycarbonylanilino)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2nc(Nc3ccc(C(=O)OC)cc3)nc(C3CC4CC3CC4c3nc(Nc4ccc(C(=O)OC)cc4)nc(Nc4ccc(C(=O)OC)cc4)n3)n2)cc1 |
| InChI | InChI=1S/C45H42N10O8/c1-60-38(56)24-5-13-30(14-6-24)46-42-50-36(51-43(54-42)47-31-15-7-25(8-16-31)39(57)61-2)34-22-29-21-28(34)23-35(29)37-52-44(48-32-17-9-26(10-18-32)40(58)62-3)55-45(53-37)49-33-19-11-27(12-20-33)41(59)63-4/h5-20,28-29,34-35H,21-23H2,1-4H3,(H2,46,47,50,51,54)(H2,48,49,52,53,55) |
| InChIKey | ACMZQJZPLRAGPJ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 230.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.89 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|