C13H12ClF3O3S — CID 18927434
4-cyclobutylsulfonyl-2-methyl-5-(trifluoromethyl)benzoyl chloride (PubChem CID 18927434) has the molecular formula C13H12ClF3O3S and a molecular weight of 340.75 g/mol. Its IUPAC name is 4-cyclobutylsulfonyl-2-methyl-5-(trifluoromethyl)benzoyl chloride.
| Compound Name | 4-cyclobutylsulfonyl-2-methyl-5-(trifluoromethyl)benzoyl chloride |
|---|---|
| PubChem CID | 18927434 |
| Molecular Formula | C13H12ClF3O3S |
| Molecular Weight | 340.75 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 4-cyclobutylsulfonyl-2-methyl-5-(trifluoromethyl)benzoyl chloride |
| SMILES | Cc1cc(S(=O)(=O)C2CCC2)c(C(F)(F)F)cc1C(=O)Cl |
| InChI | InChI=1S/C13H12ClF3O3S/c1-7-5-11(21(19,20)8-3-2-4-8)10(13(15,16)17)6-9(7)12(14)18/h5-6,8H,2-4H2,1H3 |
| InChIKey | QAEFGOCOSMEUSN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|