C17H10Cl10O2 — CID 18927743
1,2,3,4,5-pentachloro-6-[diethoxy-(2,3,4,5,6-pentachlorophenyl)methyl]benzene (PubChem CID 18927743) has the molecular formula C17H10Cl10O2 and a molecular weight of 600.80 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-[diethoxy-(2,3,4,5,6-pentachlorophenyl)methyl]benzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-[diethoxy-(2,3,4,5,6-pentachlorophenyl)methyl]benzene |
|---|---|
| PubChem CID | 18927743 |
| Molecular Formula | C17H10Cl10O2 |
| Molecular Weight | 600.80 g/mol |
| Exact Mass | 595.76 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-[diethoxy-(2,3,4,5,6-pentachlorophenyl)methyl]benzene |
| SMILES | CCOC(OCC)(c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C17H10Cl10O2/c1-3-28-17(29-4-2,5-7(18)11(22)15(26)12(23)8(5)19)6-9(20)13(24)16(27)14(25)10(6)21/h3-4H2,1-2H3 |
| InChIKey | HGGPNSXIDBPVGI-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.80 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|