C15H6Cl10O2 — CID 18927775
1,2,3,4,5-pentachloro-6-[dimethoxy-(2,3,4,5,6-pentachlorophenyl)methyl]benzene (PubChem CID 18927775) has the molecular formula C15H6Cl10O2 and a molecular weight of 572.74 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-[dimethoxy-(2,3,4,5,6-pentachlorophenyl)methyl]benzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-[dimethoxy-(2,3,4,5,6-pentachlorophenyl)methyl]benzene |
|---|---|
| PubChem CID | 18927775 |
| Molecular Formula | C15H6Cl10O2 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 567.73 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-[dimethoxy-(2,3,4,5,6-pentachlorophenyl)methyl]benzene |
| SMILES | COC(OC)(c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C15H6Cl10O2/c1-26-15(27-2,3-5(16)9(20)13(24)10(21)6(3)17)4-7(18)11(22)14(25)12(23)8(4)19/h1-2H3 |
| InChIKey | RMXMRAWBYAOWQF-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|