C8H14N2S — CID 18928573
3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-ylmethanethiol (PubChem CID 18928573) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-ylmethanethiol.
| Compound Name | 3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-ylmethanethiol |
|---|---|
| PubChem CID | 18928573 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-ylmethanethiol |
| SMILES | SCC1=NC2CCCCC2N1 |
| InChI | InChI=1S/C8H14N2S/c11-5-8-9-6-3-1-2-4-7(6)10-8/h6-7,11H,1-5H2,(H,9,10) |
| InChIKey | MRFJUSBSJQNHQH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|