C21H29ClO8 — CID 18928908
(1Z,5Z)-3-butyl-7-(1-chloropentyl)cycloocta-1,5-diene-1,2,5,6-tetracarboxylic acid (PubChem CID 18928908) has the molecular formula C21H29ClO8 and a molecular weight of 444.91 g/mol. Its IUPAC name is (1Z,5Z)-3-butyl-7-(1-chloropentyl)cycloocta-1,5-diene-1,2,5,6-tetracarboxylic acid.
| Compound Name | (1Z,5Z)-3-butyl-7-(1-chloropentyl)cycloocta-1,5-diene-1,2,5,6-tetracarboxylic acid |
|---|---|
| PubChem CID | 18928908 |
| Molecular Formula | C21H29ClO8 |
| Molecular Weight | 444.91 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (1Z,5Z)-3-butyl-7-(1-chloropentyl)cycloocta-1,5-diene-1,2,5,6-tetracarboxylic acid |
| SMILES | CCCCC1C/C(C(=O)O)=C(/C(=O)O)C(C(Cl)CCCC)C/C(C(=O)O)=C\1C(=O)O |
| InChI | InChI=1S/C21H29ClO8/c1-3-5-7-11-9-13(18(23)24)17(21(29)30)12(15(22)8-6-4-2)10-14(19(25)26)16(11)20(27)28/h11-12,15H,3-10H2,1-2H3,(H,23,24)(H,25,26)(H,27,28)(H,29,30)/b16-14-,17-13- |
| InChIKey | PBCJIZNUHYMXDZ-RGUYOHOBSA-N |
| XLogP | 3.93 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.91 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|