C10H7F5 — CID 18928984
1-ethenyl-4-(1,1,2,2,2-pentafluoroethyl)benzene (PubChem CID 18928984) has the molecular formula C10H7F5 and a molecular weight of 222.16 g/mol. Its IUPAC name is 1-ethenyl-4-(1,1,2,2,2-pentafluoroethyl)benzene.
| Compound Name | 1-ethenyl-4-(1,1,2,2,2-pentafluoroethyl)benzene |
|---|---|
| PubChem CID | 18928984 |
| Molecular Formula | C10H7F5 |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 1-ethenyl-4-(1,1,2,2,2-pentafluoroethyl)benzene |
| SMILES | C=Cc1ccc(C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H7F5/c1-2-7-3-5-8(6-4-7)9(11,12)10(13,14)15/h2-6H,1H2 |
| InChIKey | MFVDUIHKJSUENA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|