C11H9F9 — CID 18929018
5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)bicyclo[2.2.1]hept-1-ene (PubChem CID 18929018) has the molecular formula C11H9F9 and a molecular weight of 312.18 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)bicyclo[2.2.1]hept-1-ene.
| Compound Name | 5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)bicyclo[2.2.1]hept-1-ene |
|---|---|
| PubChem CID | 18929018 |
| Molecular Formula | C11H9F9 |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)bicyclo[2.2.1]hept-1-ene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C1CC2=CCC1C2 |
| InChI | InChI=1S/C11H9F9/c12-8(13,7-4-5-1-2-6(7)3-5)9(14,15)10(16,17)11(18,19)20/h1,6-7H,2-4H2 |
| InChIKey | IVWOIAXJTBGRIU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|