C5H2F10O — CID 18929310
2-[difluoro(fluoromethoxy)methyl]-1,1,1,2,3,3,3-heptafluoropropane (PubChem CID 18929310) has the molecular formula C5H2F10O and a molecular weight of 268.05 g/mol. Its IUPAC name is 2-[difluoro(fluoromethoxy)methyl]-1,1,1,2,3,3,3-heptafluoropropane.
| Compound Name | 2-[difluoro(fluoromethoxy)methyl]-1,1,1,2,3,3,3-heptafluoropropane |
|---|---|
| PubChem CID | 18929310 |
| Molecular Formula | C5H2F10O |
| Molecular Weight | 268.05 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 2-[difluoro(fluoromethoxy)methyl]-1,1,1,2,3,3,3-heptafluoropropane |
| SMILES | FCOC(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H2F10O/c6-1-16-5(14,15)2(7,3(8,9)10)4(11,12)13/h1H2 |
| InChIKey | SAAJXMOREVNDGR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.05 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |