C10H5F19O2 — CID 18929312
2-[difluoro(fluoromethoxy)methyl]-1,1,1,2,3,3,3-heptafluoropropane;2-[difluoro(methoxy)methyl]-1,1,1,2,3,3,3-heptafluoropropane (PubChem CID 18929312) has the molecular formula C10H5F19O2 and a molecular weight of 518.11 g/mol. Its IUPAC name is 2-[difluoro(fluoromethoxy)methyl]-1,1,1,2,3,3,3-heptafluoropropane;2-[difluoro(methoxy)methyl]-1,1,1,2,3,3,3-heptafluoropropane.
| Compound Name | 2-[difluoro(fluoromethoxy)methyl]-1,1,1,2,3,3,3-heptafluoropropane;2-[difluoro(methoxy)methyl]-1,1,1,2,3,3,3-heptafluoropropane |
|---|---|
| PubChem CID | 18929312 |
| Molecular Formula | C10H5F19O2 |
| Molecular Weight | 518.11 g/mol |
| Exact Mass | 518.00 |
| IUPAC Name | 2-[difluoro(fluoromethoxy)methyl]-1,1,1,2,3,3,3-heptafluoropropane;2-[difluoro(methoxy)methyl]-1,1,1,2,3,3,3-heptafluoropropane |
| SMILES | COC(F)(F)C(F)(C(F)(F)F)C(F)(F)F.FCOC(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H2F10O.C5H3F9O/c6-1-16-5(14,15)2(7,3(8,9)10)4(11,12)13;1-15-5(13,14)2(6,3(7,8)9)4(10,11)12/h1H2;1H3 |
| InChIKey | BNWOGILQFYMBPL-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.11 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |