About 4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine
4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine (PubChem CID 18929399) has the molecular formula C11H7BrCl2F3N3
and a molecular weight of 389.00 g/mol. Its IUPAC name is 4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine.
Molecular Properties
| Compound Name | 4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine |
| PubChem CID | 18929399 |
| Molecular Formula | C11H7BrCl2F3N3 |
| Molecular Weight | 389.00 g/mol |
| Exact Mass | 386.92 |
| IUPAC Name | 4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine |
| SMILES | Cn1nc(N)c(Br)c1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H7BrCl2F3N3/c1-20-9(8(12)10(18)19-20)7-5(13)2-4(3-6(7)14)11(15,16)17/h2-3H,1H3,(H2,18,19) |
| InChIKey | IOICMTOTSNKCTF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.00 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine?
The IUPAC name of 4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine (CID 18929399) is 4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine.
What is the SMILES notation for 4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine?
The canonical SMILES for 4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine is Cn1nc(N)c(Br)c1-c1c(Cl)cc(C(F)(F)F)cc1Cl.
What is the InChIKey of 4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine?
The InChIKey is IOICMTOTSNKCTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrCl2F3N3/c1-20-9(8(12)10(18)19-20)7-5(13)2-4(3-6(7)14)11(15,16)17/h2-3H,1H3,(H2,18,19).
What are the key properties of 4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine?
4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine has a molecular weight of 389.00 g/mol, XLogP of 4.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-1-methylpyrazol-3-amine is sourced from PubChem (CID 18929399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).