About 5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one
5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one (PubChem CID 18929410) has the molecular formula C11H7Cl2F3N2O
and a molecular weight of 311.09 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one |
| PubChem CID | 18929410 |
| Molecular Formula | C11H7Cl2F3N2O |
| Molecular Weight | 311.09 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one |
| SMILES | Cn1[nH]c(-c2c(Cl)cc(C(F)(F)F)cc2Cl)cc1=O |
| InChI | InChI=1S/C11H7Cl2F3N2O/c1-18-9(19)4-8(17-18)10-6(12)2-5(3-7(10)13)11(14,15)16/h2-4,17H,1H3 |
| InChIKey | YPBWPHAUVKLVOG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.09 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one?
The IUPAC name of 5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one (CID 18929410) is 5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one.
What is the SMILES notation for 5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one?
The canonical SMILES for 5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one is Cn1[nH]c(-c2c(Cl)cc(C(F)(F)F)cc2Cl)cc1=O.
What is the InChIKey of 5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one?
The InChIKey is YPBWPHAUVKLVOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl2F3N2O/c1-18-9(19)4-8(17-18)10-6(12)2-5(3-7(10)13)11(14,15)16/h2-4,17H,1H3.
What are the key properties of 5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one?
5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one has a molecular weight of 311.09 g/mol, XLogP of 3.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methyl-1H-pyrazol-3-one is sourced from PubChem (CID 18929410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).